C28H14 — CID 139963218
5-(5,7-diethynylnaphthalen-1-yl)-1,3-diethynylnaphthalene (PubChem CID 139963218) has the molecular formula C28H14 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-(5,7-diethynylnaphthalen-1-yl)-1,3-diethynylnaphthalene.
| Compound Name | 5-(5,7-diethynylnaphthalen-1-yl)-1,3-diethynylnaphthalene |
|---|---|
| PubChem CID | 139963218 |
| Molecular Formula | C28H14 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 5-(5,7-diethynylnaphthalen-1-yl)-1,3-diethynylnaphthalene |
| SMILES | C#Cc1cc(C#C)c2cccc(-c3cccc4c(C#C)cc(C#C)cc34)c2c1 |
| InChI | InChI=1S/C28H14/c1-5-19-15-21(7-3)23-11-9-13-25(27(23)17-19)26-14-10-12-24-22(8-4)16-20(6-2)18-28(24)26/h1-4,9-18H |
| InChIKey | ODRGHMDDTJQVNX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|