C13H9N — CID 87452039
2,4,6-triethynyl-N-methylaniline (PubChem CID 87452039) has the molecular formula C13H9N and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,4,6-triethynyl-N-methylaniline.
| Compound Name | 2,4,6-triethynyl-N-methylaniline |
|---|---|
| PubChem CID | 87452039 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2,4,6-triethynyl-N-methylaniline |
| SMILES | C#Cc1cc(C#C)c(NC)c(C#C)c1 |
| InChI | InChI=1S/C13H9N/c1-5-10-8-11(6-2)13(14-4)12(7-3)9-10/h1-3,8-9,14H,4H3 |
| InChIKey | AQUZIWTUXKFXRL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|