About N,4-dimethylaniline
N,4-dimethylaniline (PubChem CID 12165) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is N,4-dimethylaniline.
Molecular Properties
| Compound Name | N,4-dimethylaniline |
| PubChem CID | 12165 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N,4-dimethylaniline |
| SMILES | CNc1ccc(C)cc1 |
| InChI | InChI=1S/C8H11N/c1-7-3-5-8(9-2)6-4-7/h3-6,9H,1-2H3 |
| InChIKey | QCIFLGSATTWUQJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethylaniline?
The IUPAC name of N,4-dimethylaniline (CID 12165) is N,4-dimethylaniline.
What is the SMILES notation for N,4-dimethylaniline?
The canonical SMILES for N,4-dimethylaniline is CNc1ccc(C)cc1.
What is the InChIKey of N,4-dimethylaniline?
The InChIKey is QCIFLGSATTWUQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-7-3-5-8(9-2)6-4-7/h3-6,9H,1-2H3.
What are the key properties of N,4-dimethylaniline?
N,4-dimethylaniline has a molecular weight of 121.18 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethylaniline is sourced from PubChem (CID 12165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).