C14H9N — CID 22338949
4,8-diethynylnaphthalen-1-amine (PubChem CID 22338949) has the molecular formula C14H9N and a molecular weight of 191.23 g/mol. Its IUPAC name is 4,8-diethynylnaphthalen-1-amine.
| Compound Name | 4,8-diethynylnaphthalen-1-amine |
|---|---|
| PubChem CID | 22338949 |
| Molecular Formula | C14H9N |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4,8-diethynylnaphthalen-1-amine |
| SMILES | C#Cc1ccc(N)c2c(C#C)cccc12 |
| InChI | InChI=1S/C14H9N/c1-3-10-8-9-13(15)14-11(4-2)6-5-7-12(10)14/h1-2,5-9H,15H2 |
| InChIKey | XXWNCTPNSZGRRM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|