C14H11N — CID 21083105
bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylaniline (PubChem CID 21083105) has the molecular formula C14H11N and a molecular weight of 193.25 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylaniline.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylaniline |
|---|---|
| PubChem CID | 21083105 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylaniline |
| SMILES | C#Cc1ccccc1N.c1cc2ccc1-2 |
| InChI | InChI=1S/C8H7N.C6H4/c1-2-7-5-3-4-6-8(7)9;1-2-6-4-3-5(1)6/h1,3-6H,9H2;1-4H |
| InChIKey | PZHBHJDUSLXVTQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|