C20H10 — CID 53420148
1,8-diethynylpyrene (PubChem CID 53420148) has the molecular formula C20H10 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1,8-diethynylpyrene.
| Compound Name | 1,8-diethynylpyrene |
|---|---|
| PubChem CID | 53420148 |
| Molecular Formula | C20H10 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1,8-diethynylpyrene |
| SMILES | C#Cc1ccc2ccc3ccc(C#C)c4ccc1c2c34 |
| InChI | InChI=1S/C20H10/c1-3-13-5-7-15-9-10-16-8-6-14(4-2)18-12-11-17(13)19(15)20(16)18/h1-2,5-12H |
| InChIKey | OKIUYTCPFJRKBJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|