About 2-chloro-9,10-diethynylanthracene
2-chloro-9,10-diethynylanthracene (PubChem CID 21113563) has the molecular formula C18H9Cl
and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-chloro-9,10-diethynylanthracene.
Molecular Properties
| Compound Name | 2-chloro-9,10-diethynylanthracene |
| PubChem CID | 21113563 |
| Molecular Formula | C18H9Cl |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-chloro-9,10-diethynylanthracene |
| SMILES | C#Cc1c2ccccc2c(C#C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H9Cl/c1-3-13-15-7-5-6-8-16(15)14(4-2)18-11-12(19)9-10-17(13)18/h1-2,5-11H |
| InChIKey | CZQGJWNJLXVQGO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-9,10-diethynylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-9,10-diethynylanthracene?
The IUPAC name of 2-chloro-9,10-diethynylanthracene (CID 21113563) is 2-chloro-9,10-diethynylanthracene.
What is the SMILES notation for 2-chloro-9,10-diethynylanthracene?
The canonical SMILES for 2-chloro-9,10-diethynylanthracene is C#Cc1c2ccccc2c(C#C)c2cc(Cl)ccc12.
What is the InChIKey of 2-chloro-9,10-diethynylanthracene?
The InChIKey is CZQGJWNJLXVQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9Cl/c1-3-13-15-7-5-6-8-16(15)14(4-2)18-11-12(19)9-10-17(13)18/h1-2,5-11H.
What are the key properties of 2-chloro-9,10-diethynylanthracene?
2-chloro-9,10-diethynylanthracene has a molecular weight of 260.72 g/mol, XLogP of 4.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-9,10-diethynylanthracene is sourced from PubChem (CID 21113563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).