C22H25ClO2 — CID 139930239
9,10-di(butan-2-yloxy)-2-chloroanthracene (PubChem CID 139930239) has the molecular formula C22H25ClO2 and a molecular weight of 356.89 g/mol. Its IUPAC name is 9,10-di(butan-2-yloxy)-2-chloroanthracene.
| Compound Name | 9,10-di(butan-2-yloxy)-2-chloroanthracene |
|---|---|
| PubChem CID | 139930239 |
| Molecular Formula | C22H25ClO2 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 9,10-di(butan-2-yloxy)-2-chloroanthracene |
| SMILES | CCC(C)Oc1c2ccccc2c(OC(C)CC)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H25ClO2/c1-5-14(3)24-21-17-9-7-8-10-18(17)22(25-15(4)6-2)20-13-16(23)11-12-19(20)21/h7-15H,5-6H2,1-4H3 |
| InChIKey | CEERTGJOCRHWHT-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|