About 2-chloro-9,10-di(propan-2-yloxy)anthracene
2-chloro-9,10-di(propan-2-yloxy)anthracene (PubChem CID 139930221) has the molecular formula C20H21ClO2
and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-chloro-9,10-di(propan-2-yloxy)anthracene.
Molecular Properties
| Compound Name | 2-chloro-9,10-di(propan-2-yloxy)anthracene |
| PubChem CID | 139930221 |
| Molecular Formula | C20H21ClO2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-chloro-9,10-di(propan-2-yloxy)anthracene |
| SMILES | CC(C)Oc1c2ccccc2c(OC(C)C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H21ClO2/c1-12(2)22-19-15-7-5-6-8-16(15)20(23-13(3)4)18-11-14(21)9-10-17(18)19/h5-13H,1-4H3 |
| InChIKey | QWSIFPQFZAGIEZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-9,10-di(propan-2-yloxy)anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-9,10-di(propan-2-yloxy)anthracene?
The IUPAC name of 2-chloro-9,10-di(propan-2-yloxy)anthracene (CID 139930221) is 2-chloro-9,10-di(propan-2-yloxy)anthracene.
What is the SMILES notation for 2-chloro-9,10-di(propan-2-yloxy)anthracene?
The canonical SMILES for 2-chloro-9,10-di(propan-2-yloxy)anthracene is CC(C)Oc1c2ccccc2c(OC(C)C)c2cc(Cl)ccc12.
What is the InChIKey of 2-chloro-9,10-di(propan-2-yloxy)anthracene?
The InChIKey is QWSIFPQFZAGIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClO2/c1-12(2)22-19-15-7-5-6-8-16(15)20(23-13(3)4)18-11-14(21)9-10-17(18)19/h5-13H,1-4H3.
What are the key properties of 2-chloro-9,10-di(propan-2-yloxy)anthracene?
2-chloro-9,10-di(propan-2-yloxy)anthracene has a molecular weight of 328.84 g/mol, XLogP of 6.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-9,10-di(propan-2-yloxy)anthracene is sourced from PubChem (CID 139930221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).