C26H34O4 — CID 139929958
1,2,9,10-tetra(propan-2-yloxy)anthracene (PubChem CID 139929958) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 1,2,9,10-tetra(propan-2-yloxy)anthracene.
| Compound Name | 1,2,9,10-tetra(propan-2-yloxy)anthracene |
|---|---|
| PubChem CID | 139929958 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1,2,9,10-tetra(propan-2-yloxy)anthracene |
| SMILES | CC(C)Oc1ccc2c(OC(C)C)c3ccccc3c(OC(C)C)c2c1OC(C)C |
| InChI | InChI=1S/C26H34O4/c1-15(2)27-22-14-13-21-23(26(22)30-18(7)8)25(29-17(5)6)20-12-10-9-11-19(20)24(21)28-16(3)4/h9-18H,1-8H3 |
| InChIKey | ZUFGUZHVKXHEJQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|