About phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide
phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide (PubChem CID 161083184) has the molecular formula C14H14Br2N2Zr
and a molecular weight of 461.31 g/mol. Its IUPAC name is phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide.
Molecular Properties
| Compound Name | phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide |
| PubChem CID | 161083184 |
| Molecular Formula | C14H14Br2N2Zr |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 457.86 |
| IUPAC Name | phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide |
| SMILES | [Br-].[Br-].[Zr+4].c1ccc([N-]CC[N-]c2ccccc2)cc1 |
| InChI | InChI=1S/C14H14N2.2BrH.Zr/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14;;;/h1-10H,11-12H2;2*1H;/q-2;;;+4/p-2 |
| InChIKey | AOBPLMWXGFSXIE-UHFFFAOYSA-L |
| XLogP | -1.60 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide?
The IUPAC name of phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide (CID 161083184) is phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide.
What is the SMILES notation for phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide?
The canonical SMILES for phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide is [Br-].[Br-].[Zr+4].c1ccc([N-]CC[N-]c2ccccc2)cc1.
What is the InChIKey of phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide?
The InChIKey is AOBPLMWXGFSXIE-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H14N2.2BrH.Zr/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14;;;/h1-10H,11-12H2;2*1H;/q-2;;;+4/p-2.
What are the key properties of phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide?
phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide has a molecular weight of 461.31 g/mol, XLogP of -1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(2-phenylazanidylethyl)azanide;zirconium(4+);dibromide is sourced from PubChem (CID 161083184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).