About hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide)
hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) (PubChem CID 58249962) has the molecular formula C36H28HfN4
and a molecular weight of 695.14 g/mol. Its IUPAC name is hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide).
Molecular Properties
| Compound Name | hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) |
| PubChem CID | 58249962 |
| Molecular Formula | C36H28HfN4 |
| Molecular Weight | 695.14 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) |
| SMILES | [Hf+4].c1ccc([N-]c2ccccc2[N-]c2ccccc2)cc1.c1ccc([N-]c2ccccc2[N-]c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H14N2.Hf/c2*1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16;/h2*1-14H;/q2*-2;+4 |
| InChIKey | QNOHVJFIGSPMIB-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 695.14 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide)?
The IUPAC name of hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) (CID 58249962) is hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide).
What is the SMILES notation for hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide)?
The canonical SMILES for hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) is [Hf+4].c1ccc([N-]c2ccccc2[N-]c2ccccc2)cc1.c1ccc([N-]c2ccccc2[N-]c2ccccc2)cc1.
What is the InChIKey of hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide)?
The InChIKey is QNOHVJFIGSPMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H14N2.Hf/c2*1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16;/h2*1-14H;/q2*-2;+4.
What are the key properties of hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide)?
hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) has a molecular weight of 695.14 g/mol, XLogP of 12.72, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium(4+);bis(phenyl-(2-phenylazanidylphenyl)azanide) is sourced from PubChem (CID 58249962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).