potassium phenyl(propan-2-yl)azanide

C9H12KN — CID 141014055

IUPACpotassium phenyl(propan-2-yl)azanide
SMILESCC(C)[N-]c1ccccc1.[K+]
InChIInChI=1S/C9H12N.K/c1-8(2)10-9-6-4-3-5-7-9;/h3-8H,1-2H3;/q-1;+1
InChIKeyXFQGRNOTWFYHLI-UHFFFAOYSA-N
MW173.30 g/mol
LogP0.10
Rot. Bonds2

About potassium phenyl(propan-2-yl)azanide

potassium phenyl(propan-2-yl)azanide (PubChem CID 141014055) has the molecular formula C9H12KN and a molecular weight of 173.30 g/mol. Its IUPAC name is potassium phenyl(propan-2-yl)azanide.

Molecular Properties

Compound Namepotassium phenyl(propan-2-yl)azanide
PubChem CID141014055
Molecular FormulaC9H12KN
Molecular Weight173.30 g/mol
Exact Mass173.06
IUPAC Namepotassium phenyl(propan-2-yl)azanide
SMILESCC(C)[N-]c1ccccc1.[K+]
InChIInChI=1S/C9H12N.K/c1-8(2)10-9-6-4-3-5-7-9;/h3-8H,1-2H3;/q-1;+1
InChIKeyXFQGRNOTWFYHLI-UHFFFAOYSA-N
XLogP0.10
TPSA14.10 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.30
LogP ≤ 50.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze potassium phenyl(propan-2-yl)azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium phenyl(propan-2-yl)azanide?
The IUPAC name of potassium phenyl(propan-2-yl)azanide (CID 141014055) is potassium phenyl(propan-2-yl)azanide.
What is the SMILES notation for potassium phenyl(propan-2-yl)azanide?
The canonical SMILES for potassium phenyl(propan-2-yl)azanide is CC(C)[N-]c1ccccc1.[K+].
What is the InChIKey of potassium phenyl(propan-2-yl)azanide?
The InChIKey is XFQGRNOTWFYHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.K/c1-8(2)10-9-6-4-3-5-7-9;/h3-8H,1-2H3;/q-1;+1.
What are the key properties of potassium phenyl(propan-2-yl)azanide?
potassium phenyl(propan-2-yl)azanide has a molecular weight of 173.30 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium phenyl(propan-2-yl)azanide is sourced from PubChem (CID 141014055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).