C12H10N- — CID 177430491
cyclopenta-1,2,4-trien-1-ylmethyl(phenyl)azanide (PubChem CID 177430491) has the molecular formula C12H10N- and a molecular weight of 168.22 g/mol. Its IUPAC name is cyclopenta-1,2,4-trien-1-ylmethyl(phenyl)azanide.
| Compound Name | cyclopenta-1,2,4-trien-1-ylmethyl(phenyl)azanide |
|---|---|
| PubChem CID | 177430491 |
| Molecular Formula | C12H10N- |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | cyclopenta-1,2,4-trien-1-ylmethyl(phenyl)azanide |
| SMILES | C1=CC=CC=1C[N-]c1ccccc1 |
| InChI | InChI=1S/C12H10N/c1-2-8-12(9-3-1)13-10-11-6-4-5-7-11/h1-6,8-9H,10H2/q-1 |
| InChIKey | GEXSCFWFBVOTCE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |