About methyl(phenyl)azanide;tetrachlorotantalum
methyl(phenyl)azanide;tetrachlorotantalum (PubChem CID 135085137) has the molecular formula C7H8Cl4NTa-
and a molecular weight of 428.91 g/mol. Its IUPAC name is methyl(phenyl)azanide;tetrachlorotantalum.
Molecular Properties
| Compound Name | methyl(phenyl)azanide;tetrachlorotantalum |
| PubChem CID | 135085137 |
| Molecular Formula | C7H8Cl4NTa- |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | methyl(phenyl)azanide;tetrachlorotantalum |
| SMILES | C[N-]c1ccccc1.Cl[Ta](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8N.4ClH.Ta/c1-8-7-5-3-2-4-6-7;;;;;/h2-6H,1H3;4*1H;/q-1;;;;;+4/p-4 |
| InChIKey | KQPFMMKYPQQUQX-UHFFFAOYSA-J |
| XLogP | 5.08 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methyl(phenyl)azanide;tetrachlorotantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(phenyl)azanide;tetrachlorotantalum?
The IUPAC name of methyl(phenyl)azanide;tetrachlorotantalum (CID 135085137) is methyl(phenyl)azanide;tetrachlorotantalum.
What is the SMILES notation for methyl(phenyl)azanide;tetrachlorotantalum?
The canonical SMILES for methyl(phenyl)azanide;tetrachlorotantalum is C[N-]c1ccccc1.Cl[Ta](Cl)(Cl)Cl.
What is the InChIKey of methyl(phenyl)azanide;tetrachlorotantalum?
The InChIKey is KQPFMMKYPQQUQX-UHFFFAOYSA-J. The full InChI is InChI=1S/C7H8N.4ClH.Ta/c1-8-7-5-3-2-4-6-7;;;;;/h2-6H,1H3;4*1H;/q-1;;;;;+4/p-4.
What are the key properties of methyl(phenyl)azanide;tetrachlorotantalum?
methyl(phenyl)azanide;tetrachlorotantalum has a molecular weight of 428.91 g/mol, XLogP of 5.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(phenyl)azanide;tetrachlorotantalum is sourced from PubChem (CID 135085137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).