About dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide
dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide (PubChem CID 22968797) has the molecular formula C15H16Cl2N2Ti-2
and a molecular weight of 343.08 g/mol. Its IUPAC name is dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide.
Molecular Properties
| Compound Name | dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide |
| PubChem CID | 22968797 |
| Molecular Formula | C15H16Cl2N2Ti-2 |
| Molecular Weight | 343.08 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide |
| SMILES | C[N-]c1ccccc1Cc1ccccc1[N-]C.Cl[Ti]Cl |
| InChI | InChI=1S/C15H16N2.2ClH.Ti/c1-16-14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)17-2;;;/h3-10H,11H2,1-2H3;2*1H;/q-2;;;+2/p-2 |
| InChIKey | QGZODCFDJSTGQS-UHFFFAOYSA-L |
| XLogP | 5.92 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.08 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide?
The IUPAC name of dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide (CID 22968797) is dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide.
What is the SMILES notation for dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide?
The canonical SMILES for dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide is C[N-]c1ccccc1Cc1ccccc1[N-]C.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide?
The InChIKey is QGZODCFDJSTGQS-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H16N2.2ClH.Ti/c1-16-14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)17-2;;;/h3-10H,11H2,1-2H3;2*1H;/q-2;;;+2/p-2.
What are the key properties of dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide?
dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide has a molecular weight of 343.08 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;methyl-[2-[(2-methylazanidylphenyl)methyl]phenyl]azanide is sourced from PubChem (CID 22968797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).