C17H21NSi — CID 617479
N,N-dimethyl-4-(1-phenylsiletan-1-yl)aniline (PubChem CID 617479) has the molecular formula C17H21NSi and a molecular weight of 267.45 g/mol. Its IUPAC name is N,N-dimethyl-4-(1-phenylsiletan-1-yl)aniline.
| Compound Name | N,N-dimethyl-4-(1-phenylsiletan-1-yl)aniline |
|---|---|
| PubChem CID | 617479 |
| Molecular Formula | C17H21NSi |
| Molecular Weight | 267.45 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N,N-dimethyl-4-(1-phenylsiletan-1-yl)aniline |
| SMILES | CN(C)c1ccc([Si]2(c3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C17H21NSi/c1-18(2)15-9-11-17(12-10-15)19(13-6-14-19)16-7-4-3-5-8-16/h3-5,7-12H,6,13-14H2,1-2H3 |
| InChIKey | HDAJBPHFMSLKOJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|