C15H17NSi — CID 91538061
2,2-diphenylazasilolidine (PubChem CID 91538061) has the molecular formula C15H17NSi and a molecular weight of 239.39 g/mol. Its IUPAC name is 2,2-diphenylazasilolidine.
| Compound Name | 2,2-diphenylazasilolidine |
|---|---|
| PubChem CID | 91538061 |
| Molecular Formula | C15H17NSi |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2,2-diphenylazasilolidine |
| SMILES | c1ccc([Si]2(c3ccccc3)CCCN2)cc1 |
| InChI | InChI=1S/C15H17NSi/c1-3-8-14(9-4-1)17(13-7-12-16-17)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2 |
| InChIKey | KIRDTDJQMUGGBZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|