About 2,2-diphenylazasilolidine
2,2-diphenylazasilolidine (PubChem CID 91538061) has the molecular formula C15H17NSi
and a molecular weight of 239.39 g/mol. Its IUPAC name is 2,2-diphenylazasilolidine.
Molecular Properties
| Compound Name | 2,2-diphenylazasilolidine |
| PubChem CID | 91538061 |
| Molecular Formula | C15H17NSi |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2,2-diphenylazasilolidine |
| SMILES | c1ccc([Si]2(c3ccccc3)CCCN2)cc1 |
| InChI | InChI=1S/C15H17NSi/c1-3-8-14(9-4-1)17(13-7-12-16-17)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2 |
| InChIKey | KIRDTDJQMUGGBZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diphenylazasilolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenylazasilolidine?
The IUPAC name of 2,2-diphenylazasilolidine (CID 91538061) is 2,2-diphenylazasilolidine.
What is the SMILES notation for 2,2-diphenylazasilolidine?
The canonical SMILES for 2,2-diphenylazasilolidine is c1ccc([Si]2(c3ccccc3)CCCN2)cc1.
What is the InChIKey of 2,2-diphenylazasilolidine?
The InChIKey is KIRDTDJQMUGGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NSi/c1-3-8-14(9-4-1)17(13-7-12-16-17)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2.
What are the key properties of 2,2-diphenylazasilolidine?
2,2-diphenylazasilolidine has a molecular weight of 239.39 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenylazasilolidine is sourced from PubChem (CID 91538061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).