C26H20N4Si2 — CID 102419388
2,2,6,6-tetraphenyl-1,3,5,7-tetraza-2,6-disilacycloocta-3,4,7,8-tetraene (PubChem CID 102419388) has the molecular formula C26H20N4Si2 and a molecular weight of 444.65 g/mol. Its IUPAC name is 2,2,6,6-tetraphenyl-1,3,5,7-tetraza-2,6-disilacycloocta-3,4,7,8-tetraene.
| Compound Name | 2,2,6,6-tetraphenyl-1,3,5,7-tetraza-2,6-disilacycloocta-3,4,7,8-tetraene |
|---|---|
| PubChem CID | 102419388 |
| Molecular Formula | C26H20N4Si2 |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2,2,6,6-tetraphenyl-1,3,5,7-tetraza-2,6-disilacycloocta-3,4,7,8-tetraene |
| SMILES | C1=N[Si](c2ccccc2)(c2ccccc2)N=C=N[Si](c2ccccc2)(c2ccccc2)N=1 |
| InChI | InChI=1S/C26H20N4Si2/c1-5-13-23(14-6-1)31(24-15-7-2-8-16-24)27-21-29-32(30-22-28-31,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H |
| InChIKey | OTCIYXUSQSSJOV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|