diphenylmethylbenzene fluoride

C19H15F — CID 87590605

IUPACdiphenylmethylbenzene fluoride
SMILES[F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1
InChIInChI=1S/C19H15.FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1
InChIKeyFEQHMLSTDKZAKV-UHFFFAOYSA-M
MW262.33 g/mol
LogP1.71
Rot. Bonds3

About diphenylmethylbenzene fluoride

diphenylmethylbenzene fluoride (PubChem CID 87590605) has the molecular formula C19H15F and a molecular weight of 262.33 g/mol. Its IUPAC name is diphenylmethylbenzene fluoride.

Molecular Properties

Compound Namediphenylmethylbenzene fluoride
PubChem CID87590605
Molecular FormulaC19H15F
Molecular Weight262.33 g/mol
Exact Mass262.12
IUPAC Namediphenylmethylbenzene fluoride
SMILES[F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1
InChIInChI=1S/C19H15.FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1
InChIKeyFEQHMLSTDKZAKV-UHFFFAOYSA-M
XLogP1.71
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.33
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}

Analyze diphenylmethylbenzene fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diphenylmethylbenzene fluoride?
The IUPAC name of diphenylmethylbenzene fluoride (CID 87590605) is diphenylmethylbenzene fluoride.
What is the SMILES notation for diphenylmethylbenzene fluoride?
The canonical SMILES for diphenylmethylbenzene fluoride is [F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylmethylbenzene fluoride?
The InChIKey is FEQHMLSTDKZAKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H15.FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1.
What are the key properties of diphenylmethylbenzene fluoride?
diphenylmethylbenzene fluoride has a molecular weight of 262.33 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethylbenzene fluoride is sourced from PubChem (CID 87590605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).