About diphenylmethylbenzene fluoride
diphenylmethylbenzene fluoride (PubChem CID 87590605) has the molecular formula C19H15F
and a molecular weight of 262.33 g/mol. Its IUPAC name is diphenylmethylbenzene fluoride.
Molecular Properties
| Compound Name | diphenylmethylbenzene fluoride |
| PubChem CID | 87590605 |
| Molecular Formula | C19H15F |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | diphenylmethylbenzene fluoride |
| SMILES | [F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1 |
| InChIKey | FEQHMLSTDKZAKV-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethylbenzene fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethylbenzene fluoride?
The IUPAC name of diphenylmethylbenzene fluoride (CID 87590605) is diphenylmethylbenzene fluoride.
What is the SMILES notation for diphenylmethylbenzene fluoride?
The canonical SMILES for diphenylmethylbenzene fluoride is [F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylmethylbenzene fluoride?
The InChIKey is FEQHMLSTDKZAKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H15.FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1.
What are the key properties of diphenylmethylbenzene fluoride?
diphenylmethylbenzene fluoride has a molecular weight of 262.33 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethylbenzene fluoride is sourced from PubChem (CID 87590605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).