C51H27AlF24 — CID 23120592
diphenylmethylbenzene;tetrakis[3,5-bis(trifluoromethyl)phenyl]alumanuide (PubChem CID 23120592) has the molecular formula C51H27AlF24 and a molecular weight of 1122.71 g/mol. Its IUPAC name is diphenylmethylbenzene;tetrakis[3,5-bis(trifluoromethyl)phenyl]alumanuide.
| Compound Name | diphenylmethylbenzene;tetrakis[3,5-bis(trifluoromethyl)phenyl]alumanuide |
|---|---|
| PubChem CID | 23120592 |
| Molecular Formula | C51H27AlF24 |
| Molecular Weight | 1122.71 g/mol |
| Exact Mass | 1122.15 |
| IUPAC Name | diphenylmethylbenzene;tetrakis[3,5-bis(trifluoromethyl)phenyl]alumanuide |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)cc([Al-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.4C8H3F6.Al/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;/h1-15H;4*2-4H;/q+1;;;;;-1 |
| InChIKey | HKZZNXOBQYYZSX-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.71 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|