C27H17F6+ — CID 175242058
1-[2-(diphenylmethyl)phenyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 175242058) has the molecular formula C27H17F6+ and a molecular weight of 455.42 g/mol. Its IUPAC name is 1-[2-(diphenylmethyl)phenyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[2-(diphenylmethyl)phenyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175242058 |
| Molecular Formula | C27H17F6+ |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[2-(diphenylmethyl)phenyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(-c2ccccc2[C+](c2ccccc2)c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H17F6/c28-26(29,30)21-15-20(16-22(17-21)27(31,32)33)23-13-7-8-14-24(23)25(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H/q+1 |
| InChIKey | MOJHBAOYTKCQCD-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|