C44H22F12 — CID 172555386
1-[3,5-bis(trifluoromethyl)phenyl]-9-[1-[3,5-bis(trifluoromethyl)phenyl]anthracen-9-yl]anthracene (PubChem CID 172555386) has the molecular formula C44H22F12 and a molecular weight of 778.64 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-9-[1-[3,5-bis(trifluoromethyl)phenyl]anthracen-9-yl]anthracene.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-9-[1-[3,5-bis(trifluoromethyl)phenyl]anthracen-9-yl]anthracene |
|---|---|
| PubChem CID | 172555386 |
| Molecular Formula | C44H22F12 |
| Molecular Weight | 778.64 g/mol |
| Exact Mass | 778.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-9-[1-[3,5-bis(trifluoromethyl)phenyl]anthracen-9-yl]anthracene |
| SMILES | FC(F)(F)c1cc(-c2cccc3cc4ccccc4c(-c4c5ccccc5cc5cccc(-c6cc(C(F)(F)F)cc(C(F)(F)F)c6)c45)c23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C44H22F12/c45-41(46,47)29-17-27(18-30(21-29)42(48,49)50)35-13-5-9-25-15-23-7-1-3-11-33(23)39(37(25)35)40-34-12-4-2-8-24(34)16-26-10-6-14-36(38(26)40)28-19-31(43(51,52)53)22-32(20-28)44(54,55)56/h1-22H |
| InChIKey | JUQXVJUQBXADFV-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.64 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|