C28H17F6N — CID 132519351
1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-amine (PubChem CID 132519351) has the molecular formula C28H17F6N and a molecular weight of 481.44 g/mol. Its IUPAC name is 1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-amine.
| Compound Name | 1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 132519351 |
| Molecular Formula | C28H17F6N |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-amine |
| SMILES | Nc1ccc2ccccc2c1-c1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc2ccccc12 |
| InChI | InChI=1S/C28H17F6N/c29-27(30,31)19-13-18(14-20(15-19)28(32,33)34)23-11-9-16-5-1-3-7-21(16)25(23)26-22-8-4-2-6-17(22)10-12-24(26)35/h1-15H,35H2 |
| InChIKey | ZGXHZQOFTFUHSA-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|