C35H32F6N2 — CID 177435383
N-[1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-yl]-N',N'-di(propan-2-yl)methanediamine (PubChem CID 177435383) has the molecular formula C35H32F6N2 and a molecular weight of 594.64 g/mol. Its IUPAC name is N-[1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-yl]-N',N'-di(propan-2-yl)methanediamine.
| Compound Name | N-[1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-yl]-N',N'-di(propan-2-yl)methanediamine |
|---|---|
| PubChem CID | 177435383 |
| Molecular Formula | C35H32F6N2 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | N-[1-[2-[3,5-bis(trifluoromethyl)phenyl]naphthalen-1-yl]naphthalen-2-yl]-N',N'-di(propan-2-yl)methanediamine |
| SMILES | CC(C)N(CNc1ccc2ccccc2c1-c1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc2ccccc12)C(C)C |
| InChI | InChI=1S/C35H32F6N2/c1-21(2)43(22(3)4)20-42-31-16-14-24-10-6-8-12-29(24)33(31)32-28-11-7-5-9-23(28)13-15-30(32)25-17-26(34(36,37)38)19-27(18-25)35(39,40)41/h5-19,21-22,42H,20H2,1-4H3 |
| InChIKey | GWGLVQBVQFFQBD-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|