C22H11F12P — CID 140656274
[2,4-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]phosphane (PubChem CID 140656274) has the molecular formula C22H11F12P and a molecular weight of 534.28 g/mol. Its IUPAC name is [2,4-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]phosphane.
| Compound Name | [2,4-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 140656274 |
| Molecular Formula | C22H11F12P |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | [2,4-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]phosphane |
| SMILES | FC(F)(F)c1cc(-c2ccc(P)c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H11F12P/c23-19(24,25)13-3-11(4-14(8-13)20(26,27)28)10-1-2-18(35)17(7-10)12-5-15(21(29,30)31)9-16(6-12)22(32,33)34/h1-9H,35H2 |
| InChIKey | KRIYJMSUNTVWKY-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|