About diphenylmethylbenzene;tetrafluorostannane;fluoride
diphenylmethylbenzene;tetrafluorostannane;fluoride (PubChem CID 2723963) has the molecular formula C19H15F5Sn
and a molecular weight of 457.03 g/mol. Its IUPAC name is diphenylmethylbenzene;tetrafluorostannane;fluoride.
Molecular Properties
| Compound Name | diphenylmethylbenzene;tetrafluorostannane;fluoride |
| PubChem CID | 2723963 |
| Molecular Formula | C19H15F5Sn |
| Molecular Weight | 457.03 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | diphenylmethylbenzene;tetrafluorostannane;fluoride |
| SMILES | F[Sn](F)(F)F.[F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.5FH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
| InChIKey | QMERQMBKPLRRLS-UHFFFAOYSA-I |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.03 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethylbenzene;tetrafluorostannane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethylbenzene;tetrafluorostannane;fluoride?
The IUPAC name of diphenylmethylbenzene;tetrafluorostannane;fluoride (CID 2723963) is diphenylmethylbenzene;tetrafluorostannane;fluoride.
What is the SMILES notation for diphenylmethylbenzene;tetrafluorostannane;fluoride?
The canonical SMILES for diphenylmethylbenzene;tetrafluorostannane;fluoride is F[Sn](F)(F)F.[F-].c1ccc([C+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylmethylbenzene;tetrafluorostannane;fluoride?
The InChIKey is QMERQMBKPLRRLS-UHFFFAOYSA-I. The full InChI is InChI=1S/C19H15.5FH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5.
What are the key properties of diphenylmethylbenzene;tetrafluorostannane;fluoride?
diphenylmethylbenzene;tetrafluorostannane;fluoride has a molecular weight of 457.03 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethylbenzene;tetrafluorostannane;fluoride is sourced from PubChem (CID 2723963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).