C55H42ClN3O4 — CID 43833596
4-[bis[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline perchlorate (PubChem CID 43833596) has the molecular formula C55H42ClN3O4 and a molecular weight of 844.41 g/mol. Its IUPAC name is 4-[bis[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline perchlorate.
| Compound Name | 4-[bis[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline perchlorate |
|---|---|
| PubChem CID | 43833596 |
| Molecular Formula | C55H42ClN3O4 |
| Molecular Weight | 844.41 g/mol |
| Exact Mass | 843.29 |
| IUPAC Name | 4-[bis[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(N(c2ccccc2)c2ccc([C+](c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H42N3.ClHO4/c1-7-19-46(20-8-1)56(47-21-9-2-10-22-47)52-37-31-43(32-38-52)55(44-33-39-53(40-34-44)57(48-23-11-3-12-24-48)49-25-13-4-14-26-49)45-35-41-54(42-36-45)58(50-27-15-5-16-28-50)51-29-17-6-18-30-51;2-1(3,4)5/h1-42H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | OAHLKMOGRIPQQZ-UHFFFAOYSA-M |
| XLogP | 10.36 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.41 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|