C44H30BF5O3 — CID 87833366
dioxido-(2,3,4,5,6-pentafluorophenoxy)borane;bis(diphenylmethylbenzene) (PubChem CID 87833366) has the molecular formula C44H30BF5O3 and a molecular weight of 712.52 g/mol. Its IUPAC name is dioxido-(2,3,4,5,6-pentafluorophenoxy)borane;bis(diphenylmethylbenzene).
| Compound Name | dioxido-(2,3,4,5,6-pentafluorophenoxy)borane;bis(diphenylmethylbenzene) |
|---|---|
| PubChem CID | 87833366 |
| Molecular Formula | C44H30BF5O3 |
| Molecular Weight | 712.52 g/mol |
| Exact Mass | 712.22 |
| IUPAC Name | dioxido-(2,3,4,5,6-pentafluorophenoxy)borane;bis(diphenylmethylbenzene) |
| SMILES | [O-]B([O-])Oc1c(F)c(F)c(F)c(F)c1F.c1ccc([C+](c2ccccc2)c2ccccc2)cc1.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C19H15.C6BF5O3/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h2*1-15H;/q2*+1;-2 |
| InChIKey | ZTAIFKMKUQTCRI-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.52 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|