C55H21F30O6Ta+ — CID 11982569
diphenylmethylbenzene;hexakis(2,3,4,5,6-pentafluorophenol);tantalum (PubChem CID 11982569) has the molecular formula C55H21F30O6Ta+ and a molecular weight of 1528.65 g/mol. Its IUPAC name is diphenylmethylbenzene;hexakis(2,3,4,5,6-pentafluorophenol);tantalum.
| Compound Name | diphenylmethylbenzene;hexakis(2,3,4,5,6-pentafluorophenol);tantalum |
|---|---|
| PubChem CID | 11982569 |
| Molecular Formula | C55H21F30O6Ta+ |
| Molecular Weight | 1528.65 g/mol |
| Exact Mass | 1528.03 |
| IUPAC Name | diphenylmethylbenzene;hexakis(2,3,4,5,6-pentafluorophenol);tantalum |
| SMILES | Oc1c(F)c(F)c(F)c(F)c1F.Oc1c(F)c(F)c(F)c(F)c1F.Oc1c(F)c(F)c(F)c(F)c1F.Oc1c(F)c(F)c(F)c(F)c1F.Oc1c(F)c(F)c(F)c(F)c1F.Oc1c(F)c(F)c(F)c(F)c1F.[Ta].c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.6C6HF5O.Ta/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6*7-1-2(8)4(10)6(12)5(11)3(1)9;/h1-15H;6*12H;/q+1;;;;;;; |
| InChIKey | MLPDVWIDNLFEHT-UHFFFAOYSA-N |
| XLogP | 17.23 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1528.65 |
| LogP ≤ 5 | 17.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|