C14H13F5O2 — CID 157499271
ethane;2,3,4,5,6-pentafluorophenol;phenol (PubChem CID 157499271) has the molecular formula C14H13F5O2 and a molecular weight of 308.25 g/mol. Its IUPAC name is ethane;2,3,4,5,6-pentafluorophenol;phenol.
| Compound Name | ethane;2,3,4,5,6-pentafluorophenol;phenol |
|---|---|
| PubChem CID | 157499271 |
| Molecular Formula | C14H13F5O2 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | ethane;2,3,4,5,6-pentafluorophenol;phenol |
| SMILES | CC.Oc1c(F)c(F)c(F)c(F)c1F.Oc1ccccc1 |
| InChI | InChI=1S/C6HF5O.C6H6O.C2H6/c7-1-2(8)4(10)6(12)5(11)3(1)9;7-6-4-2-1-3-5-6;1-2/h12H;1-5,7H;1-2H3 |
| InChIKey | BYFCUSLLPVFURR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|