About diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide
diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide (PubChem CID 23120600) has the molecular formula C43H23AlF12
and a molecular weight of 794.62 g/mol. Its IUPAC name is diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide.
Molecular Properties
| Compound Name | diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide |
| PubChem CID | 23120600 |
| Molecular Formula | C43H23AlF12 |
| Molecular Weight | 794.62 g/mol |
| Exact Mass | 794.14 |
| IUPAC Name | diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide |
| SMILES | Fc1cc(F)c([Al-](c2c(F)cc(F)cc2F)(c2c(F)cc(F)cc2F)c2c(F)cc(F)cc2F)c(F)c1.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.4C6H2F3.Al/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*7-4-1-5(8)3-6(9)2-4;/h1-15H;4*1-2H;/q+1;;;;;-1 |
| InChIKey | HAXQOILEZZOUCB-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 794.62 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide?
The IUPAC name of diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide (CID 23120600) is diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide.
What is the SMILES notation for diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide?
The canonical SMILES for diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide is Fc1cc(F)c([Al-](c2c(F)cc(F)cc2F)(c2c(F)cc(F)cc2F)c2c(F)cc(F)cc2F)c(F)c1.c1ccc([C+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide?
The InChIKey is HAXQOILEZZOUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15.4C6H2F3.Al/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*7-4-1-5(8)3-6(9)2-4;/h1-15H;4*1-2H;/q+1;;;;;-1.
What are the key properties of diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide?
diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide has a molecular weight of 794.62 g/mol, XLogP of 9.44, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethylbenzene;tetrakis(2,4,6-trifluorophenyl)alumanuide is sourced from PubChem (CID 23120600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).