About dioxido(phenoxy)borane;bis(tetramethylazanium)
dioxido(phenoxy)borane;bis(tetramethylazanium) (PubChem CID 70151362) has the molecular formula C14H29BN2O3
and a molecular weight of 284.21 g/mol. Its IUPAC name is dioxido(phenoxy)borane;bis(tetramethylazanium).
Molecular Properties
| Compound Name | dioxido(phenoxy)borane;bis(tetramethylazanium) |
| PubChem CID | 70151362 |
| Molecular Formula | C14H29BN2O3 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | dioxido(phenoxy)borane;bis(tetramethylazanium) |
| SMILES | C[N+](C)(C)C.C[N+](C)(C)C.[O-]B([O-])Oc1ccccc1 |
| InChI | InChI=1S/C6H5BO3.2C4H12N/c8-7(9)10-6-4-2-1-3-5-6;2*1-5(2,3)4/h1-5H;2*1-4H3/q-2;2*+1 |
| InChIKey | HNBNDTZFLJMXOM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(phenoxy)borane;bis(tetramethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(phenoxy)borane;bis(tetramethylazanium)?
The IUPAC name of dioxido(phenoxy)borane;bis(tetramethylazanium) (CID 70151362) is dioxido(phenoxy)borane;bis(tetramethylazanium).
What is the SMILES notation for dioxido(phenoxy)borane;bis(tetramethylazanium)?
The canonical SMILES for dioxido(phenoxy)borane;bis(tetramethylazanium) is C[N+](C)(C)C.C[N+](C)(C)C.[O-]B([O-])Oc1ccccc1.
What is the InChIKey of dioxido(phenoxy)borane;bis(tetramethylazanium)?
The InChIKey is HNBNDTZFLJMXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BO3.2C4H12N/c8-7(9)10-6-4-2-1-3-5-6;2*1-5(2,3)4/h1-5H;2*1-4H3/q-2;2*+1.
What are the key properties of dioxido(phenoxy)borane;bis(tetramethylazanium)?
dioxido(phenoxy)borane;bis(tetramethylazanium) has a molecular weight of 284.21 g/mol, XLogP of -0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(phenoxy)borane;bis(tetramethylazanium) is sourced from PubChem (CID 70151362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).