About 1-tert-butyl-4,4-diphenyl-1,4-azasilinane
1-tert-butyl-4,4-diphenyl-1,4-azasilinane (PubChem CID 12930317) has the molecular formula C20H27NSi
and a molecular weight of 309.53 g/mol. Its IUPAC name is 1-tert-butyl-4,4-diphenyl-1,4-azasilinane.
Molecular Properties
| Compound Name | 1-tert-butyl-4,4-diphenyl-1,4-azasilinane |
| PubChem CID | 12930317 |
| Molecular Formula | C20H27NSi |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-tert-butyl-4,4-diphenyl-1,4-azasilinane |
| SMILES | CC(C)(C)N1CC[Si](c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27NSi/c1-20(2,3)21-14-16-22(17-15-21,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3 |
| InChIKey | NOFAAXHKEGILTM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4,4-diphenyl-1,4-azasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4,4-diphenyl-1,4-azasilinane?
The IUPAC name of 1-tert-butyl-4,4-diphenyl-1,4-azasilinane (CID 12930317) is 1-tert-butyl-4,4-diphenyl-1,4-azasilinane.
What is the SMILES notation for 1-tert-butyl-4,4-diphenyl-1,4-azasilinane?
The canonical SMILES for 1-tert-butyl-4,4-diphenyl-1,4-azasilinane is CC(C)(C)N1CC[Si](c2ccccc2)(c2ccccc2)CC1.
What is the InChIKey of 1-tert-butyl-4,4-diphenyl-1,4-azasilinane?
The InChIKey is NOFAAXHKEGILTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NSi/c1-20(2,3)21-14-16-22(17-15-21,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3.
What are the key properties of 1-tert-butyl-4,4-diphenyl-1,4-azasilinane?
1-tert-butyl-4,4-diphenyl-1,4-azasilinane has a molecular weight of 309.53 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4,4-diphenyl-1,4-azasilinane is sourced from PubChem (CID 12930317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).