C20H35ClF2Si — CID 139792218
1-chloro-4-(4,4-difluorocyclohexyl)-1-(4-propylcyclohexyl)silinane (PubChem CID 139792218) has the molecular formula C20H35ClF2Si and a molecular weight of 377.04 g/mol. Its IUPAC name is 1-chloro-4-(4,4-difluorocyclohexyl)-1-(4-propylcyclohexyl)silinane.
| Compound Name | 1-chloro-4-(4,4-difluorocyclohexyl)-1-(4-propylcyclohexyl)silinane |
|---|---|
| PubChem CID | 139792218 |
| Molecular Formula | C20H35ClF2Si |
| Molecular Weight | 377.04 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-chloro-4-(4,4-difluorocyclohexyl)-1-(4-propylcyclohexyl)silinane |
| SMILES | CCCC1CCC([Si]2(Cl)CCC(C3CCC(F)(F)CC3)CC2)CC1 |
| InChI | InChI=1S/C20H35ClF2Si/c1-2-3-16-4-6-19(7-5-16)24(21)14-10-18(11-15-24)17-8-12-20(22,23)13-9-17/h16-19H,2-15H2,1H3 |
| InChIKey | HPGUBWDZXDYNLK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.04 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|