C18H21ClSi — CID 101044385
(2R,5R)-1-chloro-1-ethyl-2,5-diphenylsilolane (PubChem CID 101044385) has the molecular formula C18H21ClSi and a molecular weight of 300.91 g/mol. Its IUPAC name is (2R,5R)-1-chloro-1-ethyl-2,5-diphenylsilolane.
| Compound Name | (2R,5R)-1-chloro-1-ethyl-2,5-diphenylsilolane |
|---|---|
| PubChem CID | 101044385 |
| Molecular Formula | C18H21ClSi |
| Molecular Weight | 300.91 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2R,5R)-1-chloro-1-ethyl-2,5-diphenylsilolane |
| SMILES | CC[Si]1(Cl)[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H21ClSi/c1-2-20(19)17(15-9-5-3-6-10-15)13-14-18(20)16-11-7-4-8-12-16/h3-12,17-18H,2,13-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | ROUCLWGLTTUVFP-QZTJIDSGSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|