About ethanethiol;1-methyl-4-phenylpiperidine
ethanethiol;1-methyl-4-phenylpiperidine (PubChem CID 142821268) has the molecular formula C14H23NS
and a molecular weight of 237.41 g/mol. Its IUPAC name is ethanethiol;1-methyl-4-phenylpiperidine.
Molecular Properties
| Compound Name | ethanethiol;1-methyl-4-phenylpiperidine |
| PubChem CID | 142821268 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | ethanethiol;1-methyl-4-phenylpiperidine |
| SMILES | CCS.CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C12H17N.C2H6S/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-3/h2-6,12H,7-10H2,1H3;3H,2H2,1H3 |
| InChIKey | KFDBMRBBQMYBPM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethiol;1-methyl-4-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethiol;1-methyl-4-phenylpiperidine?
The IUPAC name of ethanethiol;1-methyl-4-phenylpiperidine (CID 142821268) is ethanethiol;1-methyl-4-phenylpiperidine.
What is the SMILES notation for ethanethiol;1-methyl-4-phenylpiperidine?
The canonical SMILES for ethanethiol;1-methyl-4-phenylpiperidine is CCS.CN1CCC(c2ccccc2)CC1.
What is the InChIKey of ethanethiol;1-methyl-4-phenylpiperidine?
The InChIKey is KFDBMRBBQMYBPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.C2H6S/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-3/h2-6,12H,7-10H2,1H3;3H,2H2,1H3.
What are the key properties of ethanethiol;1-methyl-4-phenylpiperidine?
ethanethiol;1-methyl-4-phenylpiperidine has a molecular weight of 237.41 g/mol, XLogP of 3.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethiol;1-methyl-4-phenylpiperidine is sourced from PubChem (CID 142821268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).