C19H32N2 — CID 165124914
ethane;1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine (PubChem CID 165124914) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is ethane;1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine.
| Compound Name | ethane;1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 165124914 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | ethane;1-methyl-4-phenylpiperidine;1,2,3,6-tetrahydropyridine |
| SMILES | C1=CCNCC1.CC.CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C12H17N.C5H9N.C2H6/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-4-6-5-3-1;1-2/h2-6,12H,7-10H2,1H3;1-2,6H,3-5H2;1-2H3 |
| InChIKey | YZYBBRNJPSEBLB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|