C18H22OSi — CID 10540894
(4R,6S)-4,6-dimethyl-2,2-diphenyloxasilinane (PubChem CID 10540894) has the molecular formula C18H22OSi and a molecular weight of 282.46 g/mol. Its IUPAC name is (4R,6S)-4,6-dimethyl-2,2-diphenyloxasilinane.
| Compound Name | (4R,6S)-4,6-dimethyl-2,2-diphenyloxasilinane |
|---|---|
| PubChem CID | 10540894 |
| Molecular Formula | C18H22OSi |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (4R,6S)-4,6-dimethyl-2,2-diphenyloxasilinane |
| SMILES | C[C@@H]1C[C@H](C)O[Si](c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H22OSi/c1-15-13-16(2)19-20(14-15,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | FJZXMSOIXKXEGS-CVEARBPZSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|