C29H26OSeSi — CID 101003573
(4aR,9aS)-2,2-diphenyl-4-phenylselanyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline (PubChem CID 101003573) has the molecular formula C29H26OSeSi and a molecular weight of 497.57 g/mol. Its IUPAC name is (4aR,9aS)-2,2-diphenyl-4-phenylselanyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline.
| Compound Name | (4aR,9aS)-2,2-diphenyl-4-phenylselanyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline |
|---|---|
| PubChem CID | 101003573 |
| Molecular Formula | C29H26OSeSi |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | (4aR,9aS)-2,2-diphenyl-4-phenylselanyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline |
| SMILES | c1ccc([Se]C2C[Si](c3ccccc3)(c3ccccc3)O[C@H]3Cc4ccccc4[C@@H]23)cc1 |
| InChI | InChI=1S/C29H26OSeSi/c1-4-13-23(14-5-1)31-28-21-32(24-15-6-2-7-16-24,25-17-8-3-9-18-25)30-27-20-22-12-10-11-19-26(22)29(27)28/h1-19,27-29H,20-21H2/t27-,28?,29+/m0/s1 |
| InChIKey | USHQKBNGQBFGFE-ATQGWHGASA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|