C18H20OSi — CID 101016996
(2S,4aR,9aS)-2-methyl-2-phenyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline (PubChem CID 101016996) has the molecular formula C18H20OSi and a molecular weight of 280.44 g/mol. Its IUPAC name is (2S,4aR,9aS)-2-methyl-2-phenyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline.
| Compound Name | (2S,4aR,9aS)-2-methyl-2-phenyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline |
|---|---|
| PubChem CID | 101016996 |
| Molecular Formula | C18H20OSi |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2S,4aR,9aS)-2-methyl-2-phenyl-4,4a,9,9a-tetrahydro-3H-indeno[1,2-e]oxasiline |
| SMILES | C[Si@@]1(c2ccccc2)CC[C@@H]2c3ccccc3C[C@@H]2O1 |
| InChI | InChI=1S/C18H20OSi/c1-20(15-8-3-2-4-9-15)12-11-17-16-10-6-5-7-14(16)13-18(17)19-20/h2-10,17-18H,11-13H2,1H3/t17-,18+,20+/m1/s1 |
| InChIKey | DQXUYTJSTYWICB-HBFSDRIKSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|