C48H41NO12Si8 — CID 140674964
3-(3,5,7,9,11,13,15-heptakis-phenyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)aniline (PubChem CID 140674964) has the molecular formula C48H41NO12Si8 and a molecular weight of 1048.54 g/mol. Its IUPAC name is 3-(3,5,7,9,11,13,15-heptakis-phenyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)aniline.
| Compound Name | 3-(3,5,7,9,11,13,15-heptakis-phenyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)aniline |
|---|---|
| PubChem CID | 140674964 |
| Molecular Formula | C48H41NO12Si8 |
| Molecular Weight | 1048.54 g/mol |
| Exact Mass | 1047.08 |
| IUPAC Name | 3-(3,5,7,9,11,13,15-heptakis-phenyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)aniline |
| SMILES | Nc1cccc([Si]23O[Si]4(c5ccccc5)O[Si]5(c6ccccc6)O[Si]6(c7ccccc7)O[Si](c7ccccc7)(O4)O[Si](c4ccccc4)(O[Si](c4ccccc4)(O6)O[Si](c4ccccc4)(O5)O2)O3)c1 |
| InChI | InChI=1S/C48H41NO12Si8/c49-40-23-22-38-48(39-40)69-59-66(45-32-16-5-17-33-45)53-63(42-26-10-2-11-27-42)50-62(41-24-8-1-9-25-41)51-64(55-66,43-28-12-3-13-29-43)57-68(61-69,47-36-20-7-21-37-47)58-65(52-62,44-30-14-4-15-31-44)56-67(54-63,60-69)46-34-18-6-19-35-46/h1-39H,49H2 |
| InChIKey | NYAGMXUGMMCFCE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 136.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|