About 3-phenylphosphanylaniline;hydrate
3-phenylphosphanylaniline;hydrate (PubChem CID 158486904) has the molecular formula C12H14NOP
and a molecular weight of 219.22 g/mol. Its IUPAC name is 3-phenylphosphanylaniline;hydrate.
Molecular Properties
| Compound Name | 3-phenylphosphanylaniline;hydrate |
| PubChem CID | 158486904 |
| Molecular Formula | C12H14NOP |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-phenylphosphanylaniline;hydrate |
| SMILES | Nc1cccc(Pc2ccccc2)c1.O |
| InChI | InChI=1S/C12H12NP.H2O/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11;/h1-9,14H,13H2;1H2 |
| InChIKey | ISUMACTYHLBTSF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylphosphanylaniline;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylphosphanylaniline;hydrate?
The IUPAC name of 3-phenylphosphanylaniline;hydrate (CID 158486904) is 3-phenylphosphanylaniline;hydrate.
What is the SMILES notation for 3-phenylphosphanylaniline;hydrate?
The canonical SMILES for 3-phenylphosphanylaniline;hydrate is Nc1cccc(Pc2ccccc2)c1.O.
What is the InChIKey of 3-phenylphosphanylaniline;hydrate?
The InChIKey is ISUMACTYHLBTSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NP.H2O/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11;/h1-9,14H,13H2;1H2.
What are the key properties of 3-phenylphosphanylaniline;hydrate?
3-phenylphosphanylaniline;hydrate has a molecular weight of 219.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylphosphanylaniline;hydrate is sourced from PubChem (CID 158486904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).