C36H46O6Si6 — CID 174007704
2,4,6-tris(ethenyl)-2,4-diphenyl-6-[4-[(Z)-3-[2,4,6-trimethyl-4,6-bis(prop-2-enyl)-1,3,5,2,4,6-trioxatrisilinan-2-yl]prop-1-enyl]phenyl]-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 174007704) has the molecular formula C36H46O6Si6 and a molecular weight of 743.27 g/mol. Its IUPAC name is 2,4,6-tris(ethenyl)-2,4-diphenyl-6-[4-[(Z)-3-[2,4,6-trimethyl-4,6-bis(prop-2-enyl)-1,3,5,2,4,6-trioxatrisilinan-2-yl]prop-1-enyl]phenyl]-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-tris(ethenyl)-2,4-diphenyl-6-[4-[(Z)-3-[2,4,6-trimethyl-4,6-bis(prop-2-enyl)-1,3,5,2,4,6-trioxatrisilinan-2-yl]prop-1-enyl]phenyl]-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 174007704 |
| Molecular Formula | C36H46O6Si6 |
| Molecular Weight | 743.27 g/mol |
| Exact Mass | 742.19 |
| IUPAC Name | 2,4,6-tris(ethenyl)-2,4-diphenyl-6-[4-[(Z)-3-[2,4,6-trimethyl-4,6-bis(prop-2-enyl)-1,3,5,2,4,6-trioxatrisilinan-2-yl]prop-1-enyl]phenyl]-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C=CC[Si]1(C)O[Si](C)(CC=C)O[Si](C)(C/C=C\c2ccc([Si]3(C=C)O[Si](C=C)(c4ccccc4)O[Si](C=C)(c4ccccc4)O3)cc2)O1 |
| InChI | InChI=1S/C36H46O6Si6/c1-9-30-43(6)37-44(7,31-10-2)39-45(8,38-43)32-20-21-33-26-28-36(29-27-33)48(13-5)41-46(11-3,34-22-16-14-17-23-34)40-47(12-4,42-48)35-24-18-15-19-25-35/h9-29H,1-5,30-32H2,6-8H3/b21-20- |
| InChIKey | ZBJBXXAVHMNTOB-MRCUWXFGSA-N |
| XLogP | 6.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.27 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|