C7H16O2Si3 — CID 58725719
4,5-bis(ethenyl)-2,4,5-trimethyl-1,3,2,4,5-dioxatrisilolane (PubChem CID 58725719) has the molecular formula C7H16O2Si3 and a molecular weight of 216.46 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2,4,5-trimethyl-1,3,2,4,5-dioxatrisilolane.
| Compound Name | 4,5-bis(ethenyl)-2,4,5-trimethyl-1,3,2,4,5-dioxatrisilolane |
|---|---|
| PubChem CID | 58725719 |
| Molecular Formula | C7H16O2Si3 |
| Molecular Weight | 216.46 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4,5-bis(ethenyl)-2,4,5-trimethyl-1,3,2,4,5-dioxatrisilolane |
| SMILES | C=C[Si]1(C)O[SiH](C)O[Si]1(C)C=C |
| InChI | InChI=1S/C7H16O2Si3/c1-6-11(4)8-10(3)9-12(11,5)7-2/h6-7,10H,1-2H2,3-5H3 |
| InChIKey | NXLLJXNCLANYJD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|