C7H24O7Si5 — CID 169041111
2,6-dimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 169041111) has the molecular formula C7H24O7Si5 and a molecular weight of 360.69 g/mol. Its IUPAC name is 2,6-dimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,6-dimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 169041111 |
| Molecular Formula | C7H24O7Si5 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2,6-dimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CO[Si]1(C)O[SiH](C)O[SiH](C)O[Si](C)(OC)O[SiH](C)O1 |
| InChI | InChI=1S/C7H24O7Si5/c1-8-18(6)11-15(3)10-16(4)12-19(7,9-2)14-17(5)13-18/h15-17H,1-7H3 |
| InChIKey | UUNZXPKPFKGXBV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|