C14H36O6Si6 — CID 15760873
2,8-bis(ethenyl)-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 15760873) has the molecular formula C14H36O6Si6 and a molecular weight of 468.95 g/mol. Its IUPAC name is 2,8-bis(ethenyl)-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,8-bis(ethenyl)-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 15760873 |
| Molecular Formula | C14H36O6Si6 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2,8-bis(ethenyl)-2,4,4,6,6,8,10,10,12,12-decamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | C=C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C=C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C14H36O6Si6/c1-13-25(11)17-21(3,4)15-23(7,8)19-26(12,14-2)20-24(9,10)16-22(5,6)18-25/h13-14H,1-2H2,3-12H3 |
| InChIKey | SHCZCYQWGBXEAC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|