C12H26O4Si4 — CID 21361150
2,4,6-tris(ethenyl)-8-ethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 21361150) has the molecular formula C12H26O4Si4 and a molecular weight of 346.68 g/mol. Its IUPAC name is 2,4,6-tris(ethenyl)-8-ethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6-tris(ethenyl)-8-ethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 21361150 |
| Molecular Formula | C12H26O4Si4 |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2,4,6-tris(ethenyl)-8-ethyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si]1(C)O[Si](C)(C=C)O[Si](C)(CC)O[Si](C)(C=C)O1 |
| InChI | InChI=1S/C12H26O4Si4/c1-9-17(5)13-18(6,10-2)15-20(8,12-4)16-19(7,11-3)14-17/h9-11H,1-3,12H2,4-8H3 |
| InChIKey | ZQDTVRRCIUNVHB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|