C16H32Si4 — CID 139616644
1,2,3,4-tetrakis(ethenyl)-1,2,3,4-tetraethyltetrasiletane (PubChem CID 139616644) has the molecular formula C16H32Si4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(ethenyl)-1,2,3,4-tetraethyltetrasiletane.
| Compound Name | 1,2,3,4-tetrakis(ethenyl)-1,2,3,4-tetraethyltetrasiletane |
|---|---|
| PubChem CID | 139616644 |
| Molecular Formula | C16H32Si4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1,2,3,4-tetrakis(ethenyl)-1,2,3,4-tetraethyltetrasiletane |
| SMILES | C=C[Si]1(CC)[Si](C=C)(CC)[Si](C=C)(CC)[Si]1(C=C)CC |
| InChI | InChI=1S/C16H32Si4/c1-9-17(10-2)18(11-3,12-4)20(15-7,16-8)19(17,13-5)14-6/h9,11,13,15H,1,3,5,7,10,12,14,16H2,2,4,6,8H3 |
| InChIKey | AZVJSQCUXWJTIB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|