C7H22O5Si5 — CID 123589513
2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 123589513) has the molecular formula C7H22O5Si5 and a molecular weight of 326.68 g/mol. Its IUPAC name is 2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 123589513 |
| Molecular Formula | C7H22O5Si5 |
| Molecular Weight | 326.68 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C=C[Si]1(C)O[SiH2]O[SiH2]O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C7H22O5Si5/c1-7-17(6)10-14-8-13-9-15(2,3)11-16(4,5)12-17/h7H,1,13-14H2,2-6H3 |
| InChIKey | XHGFVMFPYVSHGR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.68 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|